About 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene
3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene (PubChem CID 12520739) has the molecular formula C11H19O3P
and a molecular weight of 230.24 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene.
Molecular Properties
| Compound Name | 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene |
| PubChem CID | 12520739 |
| Molecular Formula | C11H19O3P |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene |
| SMILES | C=CC(=C=C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H19O3P/c1-6-11(9-10(4)5)15(12,13-7-2)14-8-3/h6H,1,7-8H2,2-5H3 |
| InChIKey | WIVSRNUKACHXGB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene?
The IUPAC name of 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene (CID 12520739) is 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene.
What is the SMILES notation for 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene?
The canonical SMILES for 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene is C=CC(=C=C(C)C)P(=O)(OCC)OCC.
What is the InChIKey of 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene?
The InChIKey is WIVSRNUKACHXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19O3P/c1-6-11(9-10(4)5)15(12,13-7-2)14-8-3/h6H,1,7-8H2,2-5H3.
What are the key properties of 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene?
3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene has a molecular weight of 230.24 g/mol, XLogP of 3.89, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diethoxyphosphoryl-5-methylhexa-1,3,4-triene is sourced from PubChem (CID 12520739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).