C5F10O — CID 12520925
2,3-difluoro-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)oxirane (PubChem CID 12520925) has the molecular formula C5F10O and a molecular weight of 266.03 g/mol. Its IUPAC name is 2,3-difluoro-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)oxirane.
| Compound Name | 2,3-difluoro-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 12520925 |
| Molecular Formula | C5F10O |
| Molecular Weight | 266.03 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 2,3-difluoro-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)oxirane |
| SMILES | FC(F)(F)C(F)(F)C1(F)OC1(F)C(F)(F)F |
| InChI | InChI=1S/C5F10O/c6-1(7,4(10,11)12)2(8)3(9,16-2)5(13,14)15 |
| InChIKey | JDJXXAGSIYOKAR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.03 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|