C19H15F6N3 — CID 12520988
2,6-bis(4-methylphenyl)-4,4-bis(trifluoromethyl)-1H-1,3,5-triazine (PubChem CID 12520988) has the molecular formula C19H15F6N3 and a molecular weight of 399.34 g/mol. Its IUPAC name is 2,6-bis(4-methylphenyl)-4,4-bis(trifluoromethyl)-1H-1,3,5-triazine.
| Compound Name | 2,6-bis(4-methylphenyl)-4,4-bis(trifluoromethyl)-1H-1,3,5-triazine |
|---|---|
| PubChem CID | 12520988 |
| Molecular Formula | C19H15F6N3 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2,6-bis(4-methylphenyl)-4,4-bis(trifluoromethyl)-1H-1,3,5-triazine |
| SMILES | Cc1ccc(C2=NC(C(F)(F)F)(C(F)(F)F)N=C(c3ccc(C)cc3)N2)cc1 |
| InChI | InChI=1S/C19H15F6N3/c1-11-3-7-13(8-4-11)15-26-16(14-9-5-12(2)6-10-14)28-17(27-15,18(20,21)22)19(23,24)25/h3-10H,1-2H3,(H,26,27,28) |
| InChIKey | UZDYULLTALYVTF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |