C10F12 — CID 12521072
1,1,2,2,3,4,5,6,7-nonafluoro-3-(trifluoromethyl)indene (PubChem CID 12521072) has the molecular formula C10F12 and a molecular weight of 348.09 g/mol. Its IUPAC name is 1,1,2,2,3,4,5,6,7-nonafluoro-3-(trifluoromethyl)indene.
| Compound Name | 1,1,2,2,3,4,5,6,7-nonafluoro-3-(trifluoromethyl)indene |
|---|---|
| PubChem CID | 12521072 |
| Molecular Formula | C10F12 |
| Molecular Weight | 348.09 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 1,1,2,2,3,4,5,6,7-nonafluoro-3-(trifluoromethyl)indene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(F)C(F)(F)C2(F)C(F)(F)F |
| InChI | InChI=1S/C10F12/c11-3-1-2(4(12)6(14)5(3)13)8(16,17)9(18,19)7(1,15)10(20,21)22 |
| InChIKey | QFEAAXPVUPDIKO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.09 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|