About 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol
5-methoxy-3,6-dihydro-2H-thiopyran-3-ol (PubChem CID 12521136) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol.
Molecular Properties
| Compound Name | 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol |
| PubChem CID | 12521136 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol |
| SMILES | COC1=CC(O)CSC1 |
| InChI | InChI=1S/C6H10O2S/c1-8-6-2-5(7)3-9-4-6/h2,5,7H,3-4H2,1H3 |
| InChIKey | HNMQSWYIKUNRJE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol?
The IUPAC name of 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol (CID 12521136) is 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol.
What is the SMILES notation for 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol?
The canonical SMILES for 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol is COC1=CC(O)CSC1.
What is the InChIKey of 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol?
The InChIKey is HNMQSWYIKUNRJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c1-8-6-2-5(7)3-9-4-6/h2,5,7H,3-4H2,1H3.
What are the key properties of 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol?
5-methoxy-3,6-dihydro-2H-thiopyran-3-ol has a molecular weight of 146.21 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3,6-dihydro-2H-thiopyran-3-ol is sourced from PubChem (CID 12521136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).