C9H10N4O — CID 12521213
(1-methylbenzimidazol-5-yl)urea (PubChem CID 12521213) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is (1-methylbenzimidazol-5-yl)urea.
| Compound Name | (1-methylbenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 12521213 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | (1-methylbenzimidazol-5-yl)urea |
| SMILES | Cn1cnc2cc(NC(N)=O)ccc21 |
| InChI | InChI=1S/C9H10N4O/c1-13-5-11-7-4-6(12-9(10)14)2-3-8(7)13/h2-5H,1H3,(H3,10,12,14) |
| InChIKey | AATDBTFUDBHVBP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |