About 3-bromo-2-iodofuran
3-bromo-2-iodofuran (PubChem CID 12521510) has the molecular formula C4H2BrIO
and a molecular weight of 272.87 g/mol. Its IUPAC name is 3-bromo-2-iodofuran.
Molecular Properties
| Compound Name | 3-bromo-2-iodofuran |
| PubChem CID | 12521510 |
| Molecular Formula | C4H2BrIO |
| Molecular Weight | 272.87 g/mol |
| Exact Mass | 271.83 |
| IUPAC Name | 3-bromo-2-iodofuran |
| SMILES | Brc1ccoc1I |
| InChI | InChI=1S/C4H2BrIO/c5-3-1-2-7-4(3)6/h1-2H |
| InChIKey | HTSODYWNVCMVCF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.87 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-iodofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-iodofuran?
The IUPAC name of 3-bromo-2-iodofuran (CID 12521510) is 3-bromo-2-iodofuran.
What is the SMILES notation for 3-bromo-2-iodofuran?
The canonical SMILES for 3-bromo-2-iodofuran is Brc1ccoc1I.
What is the InChIKey of 3-bromo-2-iodofuran?
The InChIKey is HTSODYWNVCMVCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrIO/c5-3-1-2-7-4(3)6/h1-2H.
What are the key properties of 3-bromo-2-iodofuran?
3-bromo-2-iodofuran has a molecular weight of 272.87 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-iodofuran is sourced from PubChem (CID 12521510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).