C14H22N4O3S — CID 125215352
[(4aR,8aS)-4-(2-methoxyethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 125215352) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is [(4aR,8aS)-4-(2-methoxyethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [(4aR,8aS)-4-(2-methoxyethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 125215352 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [(4aR,8aS)-4-(2-methoxyethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | COCCN1CCO[C@H]2CCN(C(=O)c3snnc3C)C[C@H]21 |
| InChI | InChI=1S/C14H22N4O3S/c1-10-13(22-16-15-10)14(19)18-4-3-12-11(9-18)17(5-7-20-2)6-8-21-12/h11-12H,3-9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | CBJXQPPULDQGGP-NEPJUHHUSA-N |
| XLogP | 0.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |