C22H22F5N3O2 — CID 12521599
1-(tert-butylamino)-3-[4-[5-(2,3,4,5,6-pentafluorophenyl)-1H-imidazol-2-yl]phenoxy]propan-2-ol (PubChem CID 12521599) has the molecular formula C22H22F5N3O2 and a molecular weight of 455.43 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[4-[5-(2,3,4,5,6-pentafluorophenyl)-1H-imidazol-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-[4-[5-(2,3,4,5,6-pentafluorophenyl)-1H-imidazol-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 12521599 |
| Molecular Formula | C22H22F5N3O2 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 1-(tert-butylamino)-3-[4-[5-(2,3,4,5,6-pentafluorophenyl)-1H-imidazol-2-yl]phenoxy]propan-2-ol |
| SMILES | CC(C)(C)NCC(O)COc1ccc(-c2ncc(-c3c(F)c(F)c(F)c(F)c3F)[nH]2)cc1 |
| InChI | InChI=1S/C22H22F5N3O2/c1-22(2,3)29-8-12(31)10-32-13-6-4-11(5-7-13)21-28-9-14(30-21)15-16(23)18(25)20(27)19(26)17(15)24/h4-7,9,12,29,31H,8,10H2,1-3H3,(H,28,30) |
| InChIKey | OBSKBHYHDKISIS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|