C13H14N2OS — CID 12521634
7,8-dimethyl-1,3,5,10-tetrahydrothieno[3,4-c][1,5]benzodiazepin-4-one (PubChem CID 12521634) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is 7,8-dimethyl-1,3,5,10-tetrahydrothieno[3,4-c][1,5]benzodiazepin-4-one.
| Compound Name | 7,8-dimethyl-1,3,5,10-tetrahydrothieno[3,4-c][1,5]benzodiazepin-4-one |
|---|---|
| PubChem CID | 12521634 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 7,8-dimethyl-1,3,5,10-tetrahydrothieno[3,4-c][1,5]benzodiazepin-4-one |
| SMILES | Cc1cc2c(cc1C)NC1=C(CSC1)C(=O)N2 |
| InChI | InChI=1S/C13H14N2OS/c1-7-3-10-11(4-8(7)2)15-13(16)9-5-17-6-12(9)14-10/h3-4,14H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | RULDXZAFGWFRSQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |