C14H20FN5O2 — CID 125217106
2-[(4aS,7aS)-6-(5-fluoropyrimidin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide (PubChem CID 125217106) has the molecular formula C14H20FN5O2 and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-[(4aS,7aS)-6-(5-fluoropyrimidin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aS,7aS)-6-(5-fluoropyrimidin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 125217106 |
| Molecular Formula | C14H20FN5O2 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[(4aS,7aS)-6-(5-fluoropyrimidin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCO[C@H]2CN(c3ncc(F)cn3)C[C@@H]21 |
| InChI | InChI=1S/C14H20FN5O2/c1-18(2)13(21)9-19-3-4-22-12-8-20(7-11(12)19)14-16-5-10(15)6-17-14/h5-6,11-12H,3-4,7-9H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | OEEXRWLNSBQMFC-RYUDHWBXSA-N |
| XLogP | -0.41 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |