About N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide
N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide (PubChem CID 12521839) has the molecular formula C15H16N2O2
and a molecular weight of 256.30 g/mol. Its IUPAC name is N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide |
| PubChem CID | 12521839 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2[nH]c3ccccc3c2o1 |
| InChI | InChI=1S/C15H16N2O2/c1-3-17(4-2)15(18)13-9-12-14(19-13)10-7-5-6-8-11(10)16-12/h5-9,16H,3-4H2,1-2H3 |
| InChIKey | COBHMUZFVLMGBG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide?
The IUPAC name of N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide (CID 12521839) is N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide.
What is the SMILES notation for N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide?
The canonical SMILES for N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide is CCN(CC)C(=O)c1cc2[nH]c3ccccc3c2o1.
What is the InChIKey of N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide?
The InChIKey is COBHMUZFVLMGBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2/c1-3-17(4-2)15(18)13-9-12-14(19-13)10-7-5-6-8-11(10)16-12/h5-9,16H,3-4H2,1-2H3.
What are the key properties of N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide?
N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide has a molecular weight of 256.30 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4H-furo[3,2-b]indole-2-carboxamide is sourced from PubChem (CID 12521839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).