C13H13F3N2O — CID 125219115
1-[(4aS,9bR)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl]-2,2,2-trifluoroethanone (PubChem CID 125219115) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 1-[(4aS,9bR)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(4aS,9bR)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 125219115 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-[(4aS,9bR)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1c2ccccc2[C@@H]2CNCC[C@@H]21)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O/c14-13(15,16)12(19)18-10-4-2-1-3-8(10)9-7-17-6-5-11(9)18/h1-4,9,11,17H,5-7H2/t9-,11-/m0/s1 |
| InChIKey | PAOAEPNVXSTZBN-ONGXEEELSA-N |
| XLogP | 2.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |