C17H18N2O3S — CID 125219265
[(3S,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-2-ylmethanone (PubChem CID 125219265) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is [(3S,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3S,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 125219265 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [(3S,3aR,7aS)-3-pyridin-3-yloxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1C[C@H](Oc2cccnc2)[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C17H18N2O3S/c20-17(15-6-3-9-23-15)19-11-14(16-13(19)5-2-8-21-16)22-12-4-1-7-18-10-12/h1,3-4,6-7,9-10,13-14,16H,2,5,8,11H2/t13-,14-,16+/m0/s1 |
| InChIKey | NXPBYSHGLZYLNR-OFQRWUPVSA-N |
| XLogP | 2.59 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |