C13H18N4O3S — CID 125219688
1-[(4aR,8aS)-6-(4-methylthiadiazole-5-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone (PubChem CID 125219688) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-(4-methylthiadiazole-5-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone.
| Compound Name | 1-[(4aR,8aS)-6-(4-methylthiadiazole-5-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone |
|---|---|
| PubChem CID | 125219688 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-[(4aR,8aS)-6-(4-methylthiadiazole-5-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]ethanone |
| SMILES | CC(=O)N1CCO[C@H]2CCN(C(=O)c3snnc3C)C[C@H]21 |
| InChI | InChI=1S/C13H18N4O3S/c1-8-12(21-15-14-8)13(19)16-4-3-11-10(7-16)17(9(2)18)5-6-20-11/h10-11H,3-7H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | PBVZYSNEVTUTFL-MNOVXSKESA-N |
| XLogP | 0.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |