C14H18N4O2 — CID 125219710
(3aR,6aS)-N,N-dimethyl-5-oxo-4-pyridin-3-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxamide (PubChem CID 125219710) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is (3aR,6aS)-N,N-dimethyl-5-oxo-4-pyridin-3-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxamide.
| Compound Name | (3aR,6aS)-N,N-dimethyl-5-oxo-4-pyridin-3-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 125219710 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (3aR,6aS)-N,N-dimethyl-5-oxo-4-pyridin-3-yl-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC[C@@H]2[C@@H]1CC(=O)N2c1cccnc1 |
| InChI | InChI=1S/C14H18N4O2/c1-16(2)14(20)17-7-5-11-12(17)8-13(19)18(11)10-4-3-6-15-9-10/h3-4,6,9,11-12H,5,7-8H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | QWBQZJVJMFUGHW-NEPJUHHUSA-N |
| XLogP | 0.94 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |