About 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene
6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene (PubChem CID 12522307) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene.
Molecular Properties
| Compound Name | 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene |
| PubChem CID | 12522307 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene |
| SMILES | CC12Cc3ccccc3C1O2 |
| InChI | InChI=1S/C10H10O/c1-10-6-7-4-2-3-5-8(7)9(10)11-10/h2-5,9H,6H2,1H3 |
| InChIKey | NERZWZQNSRXDMH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene?
The IUPAC name of 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene (CID 12522307) is 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene.
What is the SMILES notation for 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene?
The canonical SMILES for 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene is CC12Cc3ccccc3C1O2.
What is the InChIKey of 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene?
The InChIKey is NERZWZQNSRXDMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c1-10-6-7-4-2-3-5-8(7)9(10)11-10/h2-5,9H,6H2,1H3.
What are the key properties of 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene?
6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene has a molecular weight of 146.19 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6a-methyl-1a,6-dihydroindeno[1,2-b]oxirene is sourced from PubChem (CID 12522307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).