C5H4F6O — CID 12522509
(E)-1,1,1,4,4,4-hexafluoro-2-methoxybut-2-ene (PubChem CID 12522509) has the molecular formula C5H4F6O and a molecular weight of 194.07 g/mol. Its IUPAC name is (E)-1,1,1,4,4,4-hexafluoro-2-methoxybut-2-ene.
| Compound Name | (E)-1,1,1,4,4,4-hexafluoro-2-methoxybut-2-ene |
|---|---|
| PubChem CID | 12522509 |
| Molecular Formula | C5H4F6O |
| Molecular Weight | 194.07 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | (E)-1,1,1,4,4,4-hexafluoro-2-methoxybut-2-ene |
| SMILES | CO/C(=C/C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H4F6O/c1-12-3(5(9,10)11)2-4(6,7)8/h2H,1H3/b3-2+ |
| InChIKey | XTOUBDXCNFGZBJ-NSCUHMNNSA-N |
| XLogP | 2.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.07 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|