C16H29N3O3S — CID 125227107
(4aR,9aS)-4-(cyclopropylmethyl)-1,1-dioxo-N-propan-2-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide (PubChem CID 125227107) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is (4aR,9aS)-4-(cyclopropylmethyl)-1,1-dioxo-N-propan-2-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide.
| Compound Name | (4aR,9aS)-4-(cyclopropylmethyl)-1,1-dioxo-N-propan-2-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide |
|---|---|
| PubChem CID | 125227107 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (4aR,9aS)-4-(cyclopropylmethyl)-1,1-dioxo-N-propan-2-yl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine-7-carboxamide |
| SMILES | CC(C)NC(=O)N1CC[C@@H]2[C@H](CC1)S(=O)(=O)CCN2CC1CC1 |
| InChI | InChI=1S/C16H29N3O3S/c1-12(2)17-16(20)18-7-5-14-15(6-8-18)23(21,22)10-9-19(14)11-13-3-4-13/h12-15H,3-11H2,1-2H3,(H,17,20)/t14-,15+/m1/s1 |
| InChIKey | HDVTVTQBGZRVSI-CABCVRRESA-N |
| XLogP | 1.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |