C15H24NO5- — CID 1252289
4-[(4S,5R)-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-2-oxo-1,3-oxazolidin-3-yl]butanoate (PubChem CID 1252289) has the molecular formula C15H24NO5- and a molecular weight of 298.36 g/mol. Its IUPAC name is 4-[(4S,5R)-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-2-oxo-1,3-oxazolidin-3-yl]butanoate.
| Compound Name | 4-[(4S,5R)-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-2-oxo-1,3-oxazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 1252289 |
| Molecular Formula | C15H24NO5- |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-[(4S,5R)-4-hydroxy-4,5-dimethyl-5-(4-methylpent-3-enyl)-2-oxo-1,3-oxazolidin-3-yl]butanoate |
| SMILES | CC(C)=CCC[C@@]1(C)OC(=O)N(CCCC(=O)[O-])[C@@]1(C)O |
| InChI | InChI=1S/C15H25NO5/c1-11(2)7-5-9-14(3)15(4,20)16(13(19)21-14)10-6-8-12(17)18/h7,20H,5-6,8-10H2,1-4H3,(H,17,18)/p-1/t14-,15+/m1/s1 |
| InChIKey | NSSGDDMZMSYFSP-CABCVRRESA-M |
| XLogP | 1.18 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|