About 2,6,10,14-tetramethylhexadecane
2,6,10,14-tetramethylhexadecane (PubChem CID 12523) has the molecular formula C20H42
and a molecular weight of 282.56 g/mol. Its IUPAC name is 2,6,10,14-tetramethylhexadecane.
Molecular Properties
| Compound Name | 2,6,10,14-tetramethylhexadecane |
| PubChem CID | 12523 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | 2,6,10,14-tetramethylhexadecane |
| SMILES | CCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H42/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h17-20H,7-16H2,1-6H3 |
| InChIKey | GGYKPYDKXLHNTI-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,6,10,14-tetramethylhexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,10,14-tetramethylhexadecane?
The IUPAC name of 2,6,10,14-tetramethylhexadecane (CID 12523) is 2,6,10,14-tetramethylhexadecane.
What is the SMILES notation for 2,6,10,14-tetramethylhexadecane?
The canonical SMILES for 2,6,10,14-tetramethylhexadecane is CCC(C)CCCC(C)CCCC(C)CCCC(C)C.
What is the InChIKey of 2,6,10,14-tetramethylhexadecane?
The InChIKey is GGYKPYDKXLHNTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h17-20H,7-16H2,1-6H3.
What are the key properties of 2,6,10,14-tetramethylhexadecane?
2,6,10,14-tetramethylhexadecane has a molecular weight of 282.56 g/mol, XLogP of 7.47, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,10,14-tetramethylhexadecane is sourced from PubChem (CID 12523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).