C20H28N2O4S — CID 125230370
[(3aS,8aR)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-cyclobutylmethanone (PubChem CID 125230370) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is [(3aS,8aR)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-cyclobutylmethanone.
| Compound Name | [(3aS,8aR)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 125230370 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [(3aS,8aR)-2-[(3-methoxyphenyl)methyl]-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-cyclobutylmethanone |
| SMILES | COc1cccc(CN2C[C@@H]3CCN(C(=O)C4CCC4)CC[C@H]3S2(=O)=O)c1 |
| InChI | InChI=1S/C20H28N2O4S/c1-26-18-7-2-4-15(12-18)13-22-14-17-8-10-21(20(23)16-5-3-6-16)11-9-19(17)27(22,24)25/h2,4,7,12,16-17,19H,3,5-6,8-11,13-14H2,1H3/t17-,19+/m0/s1 |
| InChIKey | HXQKXVNXPDAJBX-PKOBYXMFSA-N |
| XLogP | 2.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |