About 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone
1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone (PubChem CID 12523113) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone.
Molecular Properties
| Compound Name | 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone |
| PubChem CID | 12523113 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone |
| SMILES | CC(=O)c1c(O)cc(C)c(O)c1C |
| InChI | InChI=1S/C10H12O3/c1-5-4-8(12)9(7(3)11)6(2)10(5)13/h4,12-13H,1-3H3 |
| InChIKey | ICBRBTDTSCVMNK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone?
The IUPAC name of 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone (CID 12523113) is 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone.
What is the SMILES notation for 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone?
The canonical SMILES for 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone is CC(=O)c1c(O)cc(C)c(O)c1C.
What is the InChIKey of 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone?
The InChIKey is ICBRBTDTSCVMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-5-4-8(12)9(7(3)11)6(2)10(5)13/h4,12-13H,1-3H3.
What are the key properties of 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone?
1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone has a molecular weight of 180.20 g/mol, XLogP of 1.92, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dihydroxy-2,4-dimethylphenyl)ethanone is sourced from PubChem (CID 12523113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).