C21H27FN4O3 — CID 125231550
(3aS,6aS)-2-acetyl-5-ethyl-N-(4-fluorophenyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide (PubChem CID 125231550) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is (3aS,6aS)-2-acetyl-5-ethyl-N-(4-fluorophenyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide.
| Compound Name | (3aS,6aS)-2-acetyl-5-ethyl-N-(4-fluorophenyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 125231550 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (3aS,6aS)-2-acetyl-5-ethyl-N-(4-fluorophenyl)-6-oxospiro[1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1'-carboxamide |
| SMILES | CCN1C(=O)[C@@H]2CN(C(C)=O)C[C@H]2C12CCN(C(=O)Nc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C21H27FN4O3/c1-3-26-19(28)17-12-25(14(2)27)13-18(17)21(26)8-10-24(11-9-21)20(29)23-16-6-4-15(22)5-7-16/h4-7,17-18H,3,8-13H2,1-2H3,(H,23,29)/t17-,18-/m1/s1 |
| InChIKey | VPZOBVUZXXGGHU-QZTJIDSGSA-N |
| XLogP | 2.15 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |