About 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile
2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile (PubChem CID 12523560) has the molecular formula C22H16N2O
and a molecular weight of 324.38 g/mol. Its IUPAC name is 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile |
| PubChem CID | 12523560 |
| Molecular Formula | C22H16N2O |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)OC(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H16N2O/c23-16-20-21(17-10-4-1-5-11-17)25-22(18-12-6-2-7-13-18)24(20)19-14-8-3-9-15-19/h1-15,22H |
| InChIKey | MBXJXKMIEAXENN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile (CID 12523560) is 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile is N#CC1=C(c2ccccc2)OC(c2ccccc2)N1c1ccccc1.
What is the InChIKey of 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile?
The InChIKey is MBXJXKMIEAXENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O/c23-16-20-21(17-10-4-1-5-11-17)25-22(18-12-6-2-7-13-18)24(20)19-14-8-3-9-15-19/h1-15,22H.
What are the key properties of 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile?
2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile has a molecular weight of 324.38 g/mol, XLogP of 5.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-triphenyl-2H-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 12523560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).