C17H25N5O3 — CID 125238054
N-[2-[(3S,3aR,7aS)-3-[methyl(pyrimidin-5-ylmethyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-oxoethyl]acetamide (PubChem CID 125238054) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[2-[(3S,3aR,7aS)-3-[methyl(pyrimidin-5-ylmethyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-[(3S,3aR,7aS)-3-[methyl(pyrimidin-5-ylmethyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 125238054 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[2-[(3S,3aR,7aS)-3-[methyl(pyrimidin-5-ylmethyl)amino]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1C[C@H](N(C)Cc2cncnc2)[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C17H25N5O3/c1-12(23)20-8-16(24)22-10-15(17-14(22)4-3-5-25-17)21(2)9-13-6-18-11-19-7-13/h6-7,11,14-15,17H,3-5,8-10H2,1-2H3,(H,20,23)/t14-,15-,17+/m0/s1 |
| InChIKey | AHYPYHHEEBCYKL-YQQAZPJKSA-N |
| XLogP | -0.20 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |