C17H15IN2O2 — CID 1252381
5-[(3,5-dimethylphenoxy)methyl]-3-(4-iodophenyl)-1,2,4-oxadiazole (PubChem CID 1252381) has the molecular formula C17H15IN2O2 and a molecular weight of 406.22 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenoxy)methyl]-3-(4-iodophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(3,5-dimethylphenoxy)methyl]-3-(4-iodophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 1252381 |
| Molecular Formula | C17H15IN2O2 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 5-[(3,5-dimethylphenoxy)methyl]-3-(4-iodophenyl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(C)cc(OCc2nc(-c3ccc(I)cc3)no2)c1 |
| InChI | InChI=1S/C17H15IN2O2/c1-11-7-12(2)9-15(8-11)21-10-16-19-17(20-22-16)13-3-5-14(18)6-4-13/h3-9H,10H2,1-2H3 |
| InChIKey | PTCFXBUGZCIZDQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|