C18H24N6O2 — CID 125240374
(4S,4aS,8aS)-6-[(1-methylpyrazol-4-yl)methyl]-N-pyrazin-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide (PubChem CID 125240374) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (4S,4aS,8aS)-6-[(1-methylpyrazol-4-yl)methyl]-N-pyrazin-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide.
| Compound Name | (4S,4aS,8aS)-6-[(1-methylpyrazol-4-yl)methyl]-N-pyrazin-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 125240374 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (4S,4aS,8aS)-6-[(1-methylpyrazol-4-yl)methyl]-N-pyrazin-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide |
| SMILES | Cn1cc(CN2CC[C@@H]3OCC[C@H](C(=O)Nc4cnccn4)[C@H]3C2)cn1 |
| InChI | InChI=1S/C18H24N6O2/c1-23-10-13(8-21-23)11-24-6-2-16-15(12-24)14(3-7-26-16)18(25)22-17-9-19-4-5-20-17/h4-5,8-10,14-16H,2-3,6-7,11-12H2,1H3,(H,20,22,25)/t14-,15+,16-/m0/s1 |
| InChIKey | YTABLIDMGIUYFV-XHSDSOJGSA-N |
| XLogP | 1.08 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |