About 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone
1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone (PubChem CID 12524250) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone |
| PubChem CID | 12524250 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone |
| SMILES | CCSC1=NC(C)C(C(C)=O)O1 |
| InChI | InChI=1S/C8H13NO2S/c1-4-12-8-9-5(2)7(11-8)6(3)10/h5,7H,4H2,1-3H3 |
| InChIKey | HXMAGHUOTHVAJN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone?
The IUPAC name of 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone (CID 12524250) is 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone.
What is the SMILES notation for 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone?
The canonical SMILES for 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone is CCSC1=NC(C)C(C(C)=O)O1.
What is the InChIKey of 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone?
The InChIKey is HXMAGHUOTHVAJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-4-12-8-9-5(2)7(11-8)6(3)10/h5,7H,4H2,1-3H3.
What are the key properties of 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone?
1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone has a molecular weight of 187.26 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethylsulfanyl-4-methyl-4,5-dihydro-1,3-oxazol-5-yl)ethanone is sourced from PubChem (CID 12524250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).