About 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone
1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone (PubChem CID 12524252) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone |
| PubChem CID | 12524252 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone |
| SMILES | CC(=O)C1OC(SC(C)C)=NC1(C)C |
| InChI | InChI=1S/C10H17NO2S/c1-6(2)14-9-11-10(4,5)8(13-9)7(3)12/h6,8H,1-5H3 |
| InChIKey | QDIGFQJCUKEDLL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone?
The IUPAC name of 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone (CID 12524252) is 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone.
What is the SMILES notation for 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone?
The canonical SMILES for 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone is CC(=O)C1OC(SC(C)C)=NC1(C)C.
What is the InChIKey of 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone?
The InChIKey is QDIGFQJCUKEDLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S/c1-6(2)14-9-11-10(4,5)8(13-9)7(3)12/h6,8H,1-5H3.
What are the key properties of 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone?
1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone has a molecular weight of 215.32 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethyl-2-propan-2-ylsulfanyl-5H-1,3-oxazol-5-yl)ethanone is sourced from PubChem (CID 12524252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).