C15H22FN5O2 — CID 125246854
3-[[(1R,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]-1,1-dimethylurea (PubChem CID 125246854) has the molecular formula C15H22FN5O2 and a molecular weight of 323.37 g/mol. Its IUPAC name is 3-[[(1R,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]-1,1-dimethylurea.
| Compound Name | 3-[[(1R,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 125246854 |
| Molecular Formula | C15H22FN5O2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 3-[[(1R,3aR,7aR)-5-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC[C@@H]1OC[C@H]2CN(c3ncc(F)cn3)CC[C@H]21 |
| InChI | InChI=1S/C15H22FN5O2/c1-20(2)15(22)19-7-13-12-3-4-21(8-10(12)9-23-13)14-17-5-11(16)6-18-14/h5-6,10,12-13H,3-4,7-9H2,1-2H3,(H,19,22)/t10-,12-,13+/m1/s1 |
| InChIKey | YSUMUIVGDCXVTH-RTXFEEFZSA-N |
| XLogP | 0.73 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |