C20H33N5O3S — CID 125247929
(3aS,8aR)-N-(cyclopropylmethyl)-5-ethylsulfonyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide (PubChem CID 125247929) has the molecular formula C20H33N5O3S and a molecular weight of 423.58 g/mol. Its IUPAC name is (3aS,8aR)-N-(cyclopropylmethyl)-5-ethylsulfonyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide.
| Compound Name | (3aS,8aR)-N-(cyclopropylmethyl)-5-ethylsulfonyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide |
|---|---|
| PubChem CID | 125247929 |
| Molecular Formula | C20H33N5O3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (3aS,8aR)-N-(cyclopropylmethyl)-5-ethylsulfonyl-2-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC[C@]2(C(=O)NCC3CC3)CN(Cc3cnn(C)c3)C[C@H]2C1 |
| InChI | InChI=1S/C20H33N5O3S/c1-3-29(27,28)25-8-4-7-20(19(26)21-9-16-5-6-16)15-24(13-18(20)14-25)12-17-10-22-23(2)11-17/h10-11,16,18H,3-9,12-15H2,1-2H3,(H,21,26)/t18-,20-/m0/s1 |
| InChIKey | XTQAIOYFHWRQNQ-ICSRJNTNSA-N |
| XLogP | 0.81 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |