About 8-methyl-[1]benzofuro[2,3-d]pyridazine
8-methyl-[1]benzofuro[2,3-d]pyridazine (PubChem CID 12524840) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 8-methyl-[1]benzofuro[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 8-methyl-[1]benzofuro[2,3-d]pyridazine |
| PubChem CID | 12524840 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 8-methyl-[1]benzofuro[2,3-d]pyridazine |
| SMILES | Cc1ccc2oc3cnncc3c2c1 |
| InChI | InChI=1S/C11H8N2O/c1-7-2-3-10-8(4-7)9-5-12-13-6-11(9)14-10/h2-6H,1H3 |
| InChIKey | MFSXNGSFTBZEPN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-[1]benzofuro[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-[1]benzofuro[2,3-d]pyridazine?
The IUPAC name of 8-methyl-[1]benzofuro[2,3-d]pyridazine (CID 12524840) is 8-methyl-[1]benzofuro[2,3-d]pyridazine.
What is the SMILES notation for 8-methyl-[1]benzofuro[2,3-d]pyridazine?
The canonical SMILES for 8-methyl-[1]benzofuro[2,3-d]pyridazine is Cc1ccc2oc3cnncc3c2c1.
What is the InChIKey of 8-methyl-[1]benzofuro[2,3-d]pyridazine?
The InChIKey is MFSXNGSFTBZEPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c1-7-2-3-10-8(4-7)9-5-12-13-6-11(9)14-10/h2-6H,1H3.
What are the key properties of 8-methyl-[1]benzofuro[2,3-d]pyridazine?
8-methyl-[1]benzofuro[2,3-d]pyridazine has a molecular weight of 184.20 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-[1]benzofuro[2,3-d]pyridazine is sourced from PubChem (CID 12524840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).