About bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate
bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate (PubChem CID 12525173) has the molecular formula C34H54O10
and a molecular weight of 622.80 g/mol. Its IUPAC name is bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate.
Molecular Properties
| Compound Name | bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate |
| PubChem CID | 12525173 |
| Molecular Formula | C34H54O10 |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate |
| SMILES | C=CCOCC(COCC=C)(COCC=C)COC(=O)CCCCC(=O)OCC(COCC=C)(COCC=C)COCC=C |
| InChI | InChI=1S/C34H54O10/c1-7-17-37-23-33(24-38-18-8-2,25-39-19-9-3)29-43-31(35)15-13-14-16-32(36)44-30-34(26-40-20-10-4,27-41-21-11-5)28-42-22-12-6/h7-12H,1-6,13-30H2 |
| InChIKey | JHAPQLJCYVVKMQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate?
The IUPAC name of bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate (CID 12525173) is bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate.
What is the SMILES notation for bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate?
The canonical SMILES for bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate is C=CCOCC(COCC=C)(COCC=C)COC(=O)CCCCC(=O)OCC(COCC=C)(COCC=C)COCC=C.
What is the InChIKey of bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate?
The InChIKey is JHAPQLJCYVVKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H54O10/c1-7-17-37-23-33(24-38-18-8-2,25-39-19-9-3)29-43-31(35)15-13-14-16-32(36)44-30-34(26-40-20-10-4,27-41-21-11-5)28-42-22-12-6/h7-12H,1-6,13-30H2.
What are the key properties of bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate?
bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate has a molecular weight of 622.80 g/mol, XLogP of 4.82, 33 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propyl] hexanedioate is sourced from PubChem (CID 12525173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).