About [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate
[(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate (PubChem CID 12525204) has the molecular formula C10H13Cl3O3
and a molecular weight of 287.57 g/mol. Its IUPAC name is [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate.
Molecular Properties
| Compound Name | [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate |
| PubChem CID | 12525204 |
| Molecular Formula | C10H13Cl3O3 |
| Molecular Weight | 287.57 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)O[C@H](C=C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H13Cl3O3/c1-6(2)4-8(10(11,12)13)16-9(15)5-7(3)14/h4,8H,5H2,1-3H3/t8-/m1/s1 |
| InChIKey | LTQCNDABBUXCCA-MRVPVSSYSA-N |
| XLogP | 3.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate?
The IUPAC name of [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate (CID 12525204) is [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate.
What is the SMILES notation for [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate?
The canonical SMILES for [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate is CC(=O)CC(=O)O[C@H](C=C(C)C)C(Cl)(Cl)Cl.
What is the InChIKey of [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate?
The InChIKey is LTQCNDABBUXCCA-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H13Cl3O3/c1-6(2)4-8(10(11,12)13)16-9(15)5-7(3)14/h4,8H,5H2,1-3H3/t8-/m1/s1.
What are the key properties of [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate?
[(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate has a molecular weight of 287.57 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1,1,1-trichloro-4-methylpent-3-en-2-yl] 3-oxobutanoate is sourced from PubChem (CID 12525204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).