C16H21N5OS — CID 125253292
(3aS,6aS)-2-[(1-methylimidazol-2-yl)methyl]-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one (PubChem CID 125253292) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is (3aS,6aS)-2-[(1-methylimidazol-2-yl)methyl]-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one.
| Compound Name | (3aS,6aS)-2-[(1-methylimidazol-2-yl)methyl]-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 125253292 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (3aS,6aS)-2-[(1-methylimidazol-2-yl)methyl]-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one |
| SMILES | Cc1nc(CN2C[C@@H]3CN(Cc4nccn4C)C[C@H]3C2=O)cs1 |
| InChI | InChI=1S/C16H21N5OS/c1-11-18-13(10-23-11)7-21-6-12-5-20(8-14(12)16(21)22)9-15-17-3-4-19(15)2/h3-4,10,12,14H,5-9H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | SAMVLGNRDUWPMD-GXTWGEPZSA-N |
| XLogP | 1.28 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |