C12F18 — CID 12525332
1,1,2,2,3,3,4-heptafluoro-4-[3,3,4,4-tetrafluoro-2-(1,2,2,3,3,4,4-heptafluorocyclobutyl)cyclobuten-1-yl]cyclobutane (PubChem CID 12525332) has the molecular formula C12F18 and a molecular weight of 486.10 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluoro-4-[3,3,4,4-tetrafluoro-2-(1,2,2,3,3,4,4-heptafluorocyclobutyl)cyclobuten-1-yl]cyclobutane.
| Compound Name | 1,1,2,2,3,3,4-heptafluoro-4-[3,3,4,4-tetrafluoro-2-(1,2,2,3,3,4,4-heptafluorocyclobutyl)cyclobuten-1-yl]cyclobutane |
|---|---|
| PubChem CID | 12525332 |
| Molecular Formula | C12F18 |
| Molecular Weight | 486.10 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluoro-4-[3,3,4,4-tetrafluoro-2-(1,2,2,3,3,4,4-heptafluorocyclobutyl)cyclobuten-1-yl]cyclobutane |
| SMILES | FC1(F)C(C2(F)C(F)(F)C(F)(F)C2(F)F)=C(C2(F)C(F)(F)C(F)(F)C2(F)F)C1(F)F |
| InChI | InChI=1S/C12F18/c13-3(7(19,20)11(27,28)8(3,21)22)1-2(6(17,18)5(1,15)16)4(14)9(23,24)12(29,30)10(4,25)26 |
| InChIKey | YIXIMAOOUNOPMK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.10 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|