C8F12 — CID 12525334
1,1,2,2,3,3,4-heptafluoro-4-(2,3,3,4,4-pentafluorocyclobuten-1-yl)cyclobutane (PubChem CID 12525334) has the molecular formula C8F12 and a molecular weight of 324.06 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluoro-4-(2,3,3,4,4-pentafluorocyclobuten-1-yl)cyclobutane.
| Compound Name | 1,1,2,2,3,3,4-heptafluoro-4-(2,3,3,4,4-pentafluorocyclobuten-1-yl)cyclobutane |
|---|---|
| PubChem CID | 12525334 |
| Molecular Formula | C8F12 |
| Molecular Weight | 324.06 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluoro-4-(2,3,3,4,4-pentafluorocyclobuten-1-yl)cyclobutane |
| SMILES | FC1=C(C2(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F12/c9-2-1(4(11,12)5(2,13)14)3(10)6(15,16)8(19,20)7(3,17)18 |
| InChIKey | SLFYQMTUBVEDBT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.06 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|