C20H27NP+ — CID 12525360
2,2,6,6-tetramethyl-4,4-diphenyl-1,4-azaphosphinan-4-ium (PubChem CID 12525360) has the molecular formula C20H27NP+ and a molecular weight of 312.42 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4,4-diphenyl-1,4-azaphosphinan-4-ium.
| Compound Name | 2,2,6,6-tetramethyl-4,4-diphenyl-1,4-azaphosphinan-4-ium |
|---|---|
| PubChem CID | 12525360 |
| Molecular Formula | C20H27NP+ |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 2,2,6,6-tetramethyl-4,4-diphenyl-1,4-azaphosphinan-4-ium |
| SMILES | CC1(C)C[P+](c2ccccc2)(c2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C20H27NP/c1-19(2)15-22(16-20(3,4)21-19,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,21H,15-16H2,1-4H3/q+1 |
| InChIKey | IZPHTSHSBLKYCT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|