About copper bis(hex-1-ene)
copper bis(hex-1-ene) (PubChem CID 12525548) has the molecular formula C12H22Cu
and a molecular weight of 229.85 g/mol. Its IUPAC name is copper bis(hex-1-ene).
Molecular Properties
| Compound Name | copper bis(hex-1-ene) |
| PubChem CID | 12525548 |
| Molecular Formula | C12H22Cu |
| Molecular Weight | 229.85 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | copper bis(hex-1-ene) |
| SMILES | [Cu+2].[H]/[C-]=C\CCCC.[H]/[C-]=C\CCCC |
| InChI | InChI=1S/2C6H11.Cu/c2*1-3-5-6-4-2;/h2*1,3H,4-6H2,2H3;/q2*-1;+2 |
| InChIKey | GESGZYNPXYVCQV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper bis(hex-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(hex-1-ene)?
The IUPAC name of copper bis(hex-1-ene) (CID 12525548) is copper bis(hex-1-ene).
What is the SMILES notation for copper bis(hex-1-ene)?
The canonical SMILES for copper bis(hex-1-ene) is [Cu+2].[H]/[C-]=C\CCCC.[H]/[C-]=C\CCCC.
What is the InChIKey of copper bis(hex-1-ene)?
The InChIKey is GESGZYNPXYVCQV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11.Cu/c2*1-3-5-6-4-2;/h2*1,3H,4-6H2,2H3;/q2*-1;+2.
What are the key properties of copper bis(hex-1-ene)?
copper bis(hex-1-ene) has a molecular weight of 229.85 g/mol, XLogP of 4.33, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(hex-1-ene) is sourced from PubChem (CID 12525548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).