About 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid
2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid (PubChem CID 1252566) has the molecular formula C24H17N3O4S
and a molecular weight of 443.48 g/mol. Its IUPAC name is 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid |
| PubChem CID | 1252566 |
| Molecular Formula | C24H17N3O4S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid |
| SMILES | O=C(Nc1nccs1)c1ccc(NC(=O)c2ccccc2-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H17N3O4S/c28-21(27-24-25-13-14-32-24)15-9-11-16(12-10-15)26-22(29)19-7-3-1-5-17(19)18-6-2-4-8-20(18)23(30)31/h1-14H,(H,26,29)(H,30,31)(H,25,27,28) |
| InChIKey | XQBXQMIAEXFFNF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid?
The IUPAC name of 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid (CID 1252566) is 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid.
What is the SMILES notation for 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid?
The canonical SMILES for 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid is O=C(Nc1nccs1)c1ccc(NC(=O)c2ccccc2-c2ccccc2C(=O)O)cc1.
What is the InChIKey of 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid?
The InChIKey is XQBXQMIAEXFFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N3O4S/c28-21(27-24-25-13-14-32-24)15-9-11-16(12-10-15)26-22(29)19-7-3-1-5-17(19)18-6-2-4-8-20(18)23(30)31/h1-14H,(H,26,29)(H,30,31)(H,25,27,28).
What are the key properties of 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid?
2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid has a molecular weight of 443.48 g/mol, XLogP of 5.01, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]carbamoyl]phenyl]benzoic acid is sourced from PubChem (CID 1252566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).