About 1-benzothiophen-2-amine
1-benzothiophen-2-amine (PubChem CID 12526004) has the molecular formula C8H7NS
and a molecular weight of 149.22 g/mol. Its IUPAC name is 1-benzothiophen-2-amine.
Molecular Properties
| Compound Name | 1-benzothiophen-2-amine |
| PubChem CID | 12526004 |
| Molecular Formula | C8H7NS |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 1-benzothiophen-2-amine |
| SMILES | Nc1cc2ccccc2s1 |
| InChI | InChI=1S/C8H7NS/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5H,9H2 |
| InChIKey | VJYJBBMMLIDJEF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-2-amine?
The IUPAC name of 1-benzothiophen-2-amine (CID 12526004) is 1-benzothiophen-2-amine.
What is the SMILES notation for 1-benzothiophen-2-amine?
The canonical SMILES for 1-benzothiophen-2-amine is Nc1cc2ccccc2s1.
What is the InChIKey of 1-benzothiophen-2-amine?
The InChIKey is VJYJBBMMLIDJEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5H,9H2.
What are the key properties of 1-benzothiophen-2-amine?
1-benzothiophen-2-amine has a molecular weight of 149.22 g/mol, XLogP of 2.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-2-amine is sourced from PubChem (CID 12526004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).