C12H21N5 — CID 125263653
(2R,3aS,7aR)-1,5-dimethyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 125263653) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2R,3aS,7aR)-1,5-dimethyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | (2R,3aS,7aR)-1,5-dimethyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 125263653 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | (2R,3aS,7aR)-1,5-dimethyl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CN1CC[C@@H]2[C@@H](C[C@H](Cn3cncn3)N2C)C1 |
| InChI | InChI=1S/C12H21N5/c1-15-4-3-12-10(6-15)5-11(16(12)2)7-17-9-13-8-14-17/h8-12H,3-7H2,1-2H3/t10-,11+,12+/m0/s1 |
| InChIKey | RPQBGHLFEXKHKB-QJPTWQEYSA-N |
| XLogP | 0.30 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |