About 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine
5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine (PubChem CID 12526370) has the molecular formula C8H10N4S2
and a molecular weight of 226.33 g/mol. Its IUPAC name is 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine.
Molecular Properties
| Compound Name | 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine |
| PubChem CID | 12526370 |
| Molecular Formula | C8H10N4S2 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine |
| SMILES | Nc1snc2nc(N3CCCC3)sc12 |
| InChI | InChI=1S/C8H10N4S2/c9-6-5-7(11-14-6)10-8(13-5)12-3-1-2-4-12/h1-4,9H2 |
| InChIKey | VGKBCSUFSFOIMN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine?
The IUPAC name of 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine (CID 12526370) is 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine.
What is the SMILES notation for 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine?
The canonical SMILES for 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine is Nc1snc2nc(N3CCCC3)sc12.
What is the InChIKey of 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine?
The InChIKey is VGKBCSUFSFOIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S2/c9-6-5-7(11-14-6)10-8(13-5)12-3-1-2-4-12/h1-4,9H2.
What are the key properties of 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine?
5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine has a molecular weight of 226.33 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrolidin-1-yl-[1,2]thiazolo[3,4-d][1,3]thiazol-3-amine is sourced from PubChem (CID 12526370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).