About 1-N',3-N'-dimethylpropanediimidamide
1-N',3-N'-dimethylpropanediimidamide (PubChem CID 12526536) has the molecular formula C5H12N4
and a molecular weight of 128.18 g/mol. Its IUPAC name is 1-N',3-N'-dimethylpropanediimidamide.
Molecular Properties
| Compound Name | 1-N',3-N'-dimethylpropanediimidamide |
| PubChem CID | 12526536 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 1-N',3-N'-dimethylpropanediimidamide |
| SMILES | C/N=C(\N)C/C(N)=N/C |
| InChI | InChI=1S/C5H12N4/c1-8-4(6)3-5(7)9-2/h3H2,1-2H3,(H2,6,8)(H2,7,9) |
| InChIKey | NGUWPCQTDJOXNB-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-N',3-N'-dimethylpropanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N',3-N'-dimethylpropanediimidamide?
The IUPAC name of 1-N',3-N'-dimethylpropanediimidamide (CID 12526536) is 1-N',3-N'-dimethylpropanediimidamide.
What is the SMILES notation for 1-N',3-N'-dimethylpropanediimidamide?
The canonical SMILES for 1-N',3-N'-dimethylpropanediimidamide is C/N=C(\N)C/C(N)=N/C.
What is the InChIKey of 1-N',3-N'-dimethylpropanediimidamide?
The InChIKey is NGUWPCQTDJOXNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4/c1-8-4(6)3-5(7)9-2/h3H2,1-2H3,(H2,6,8)(H2,7,9).
What are the key properties of 1-N',3-N'-dimethylpropanediimidamide?
1-N',3-N'-dimethylpropanediimidamide has a molecular weight of 128.18 g/mol, XLogP of -0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N',3-N'-dimethylpropanediimidamide is sourced from PubChem (CID 12526536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).