About 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one
1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one (PubChem CID 12526566) has the molecular formula C12H22O2S
and a molecular weight of 230.37 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one |
| PubChem CID | 12526566 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CSCC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22O2S/c1-11(2,3)9(13)7-15-8-10(14)12(4,5)6/h7-8H2,1-6H3 |
| InChIKey | YJIYAPYIDHRFER-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one?
The IUPAC name of 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one (CID 12526566) is 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)CSCC(=O)C(C)(C)C.
What is the InChIKey of 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one?
The InChIKey is YJIYAPYIDHRFER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2S/c1-11(2,3)9(13)7-15-8-10(14)12(4,5)6/h7-8H2,1-6H3.
What are the key properties of 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one?
1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one has a molecular weight of 230.37 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,3-dimethylbutan-2-one is sourced from PubChem (CID 12526566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).