About (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine
(E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine (PubChem CID 12526703) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine.
Molecular Properties
| Compound Name | (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine |
| PubChem CID | 12526703 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine |
| SMILES | CC12CCC(C1)C(C)(C)/C2=N/N |
| InChI | InChI=1S/C10H18N2/c1-9(2)7-4-5-10(3,6-7)8(9)12-11/h7H,4-6,11H2,1-3H3/b12-8- |
| InChIKey | PAIGSTUXPRTCJO-WQLSENKSSA-N |
| XLogP | 2.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine?
The IUPAC name of (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine (CID 12526703) is (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine.
What is the SMILES notation for (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine?
The canonical SMILES for (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine is CC12CCC(C1)C(C)(C)/C2=N/N.
What is the InChIKey of (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine?
The InChIKey is PAIGSTUXPRTCJO-WQLSENKSSA-N. The full InChI is InChI=1S/C10H18N2/c1-9(2)7-4-5-10(3,6-7)8(9)12-11/h7H,4-6,11H2,1-3H3/b12-8-.
What are the key properties of (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine?
(E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine has a molecular weight of 166.27 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazine is sourced from PubChem (CID 12526703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).