C7H8N4O — CID 12527221
3,8-dimethylimidazo[1,5-a][1,3,5]triazin-4-one (PubChem CID 12527221) has the molecular formula C7H8N4O and a molecular weight of 164.17 g/mol. Its IUPAC name is 3,8-dimethylimidazo[1,5-a][1,3,5]triazin-4-one.
| Compound Name | 3,8-dimethylimidazo[1,5-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 12527221 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3,8-dimethylimidazo[1,5-a][1,3,5]triazin-4-one |
| SMILES | Cc1ncn2c(=O)n(C)cnc12 |
| InChI | InChI=1S/C7H8N4O/c1-5-6-9-3-10(2)7(12)11(6)4-8-5/h3-4H,1-2H3 |
| InChIKey | WAGGLHPFZDAMPY-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |