C32H38N4O4 — CID 125272785
ethyl N-[5-[3-(diethylamino)propyl]-8-(ethoxycarbonylamino)-6-phenylphenanthridin-3-ylidene]carbamate (PubChem CID 125272785) has the molecular formula C32H38N4O4 and a molecular weight of 542.68 g/mol. Its IUPAC name is ethyl N-[5-[3-(diethylamino)propyl]-8-(ethoxycarbonylamino)-6-phenylphenanthridin-3-ylidene]carbamate.
| Compound Name | ethyl N-[5-[3-(diethylamino)propyl]-8-(ethoxycarbonylamino)-6-phenylphenanthridin-3-ylidene]carbamate |
|---|---|
| PubChem CID | 125272785 |
| Molecular Formula | C32H38N4O4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | ethyl N-[5-[3-(diethylamino)propyl]-8-(ethoxycarbonylamino)-6-phenylphenanthridin-3-ylidene]carbamate |
| SMILES | CCOC(=O)N=c1ccc2c3ccc(NC(=O)OCC)cc3c(-c3ccccc3)n(CCCN(CC)CC)c-2c1 |
| InChI | InChI=1S/C32H38N4O4/c1-5-35(6-2)19-12-20-36-29-22-25(34-32(38)40-8-4)16-18-27(29)26-17-15-24(33-31(37)39-7-3)21-28(26)30(36)23-13-10-9-11-14-23/h9-11,13-18,21-22H,5-8,12,19-20H2,1-4H3,(H,33,37) |
| InChIKey | DQIPLULBZCEFGJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|