About 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile
3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile (PubChem CID 12529296) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile |
| PubChem CID | 12529296 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile |
| SMILES | CCC1=NOC(C#N)C1 |
| InChI | InChI=1S/C6H8N2O/c1-2-5-3-6(4-7)9-8-5/h6H,2-3H2,1H3 |
| InChIKey | OQPITXAMDVBSMP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The IUPAC name of 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile (CID 12529296) is 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile.
What is the SMILES notation for 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The canonical SMILES for 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile is CCC1=NOC(C#N)C1.
What is the InChIKey of 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The InChIKey is OQPITXAMDVBSMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c1-2-5-3-6(4-7)9-8-5/h6H,2-3H2,1H3.
What are the key properties of 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile?
3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile has a molecular weight of 124.14 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonitrile is sourced from PubChem (CID 12529296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).